Introduction:Basic information about CAS 2401-85-6|1-Chloro-2,4-dinitronaphthalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Chloro-2,4-dinitronaphthalene |
|---|
| CAS Number | 2401-85-6 | Molecular Weight | 252.61100 |
|---|
| Density | 1.586g/cm3 | Boiling Point | 404.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H5ClN2O4 | Melting Point | 146.5ºC |
|---|
| MSDS | / | Flash Point | 198.3ºC |
|---|
Names
| Name | chlorodinitronaphthalenes |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.586g/cm3 |
|---|
| Boiling Point | 404.3ºC at 760mmHg |
|---|
| Melting Point | 146.5ºC |
|---|
| Molecular Formula | C10H5ClN2O4 |
|---|
| Molecular Weight | 252.61100 |
|---|
| Flash Point | 198.3ºC |
|---|
| Exact Mass | 251.99400 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 4.35600 |
|---|
| Vapour Pressure | 2.24E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | SKKUAUZTZZRYPW-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2ccccc2c1Cl |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,4-dinitro-1-chloro-naphthaline |
| 1-chloro-2,4-dinitronaphthalene |
| 2,4-Dinitro-1-naphthyl chloride |
| AmbscLK-296 |
| Naphthalene,1-chloro-2,4-dinitro |
| 2,4-dinitrochloronaphthalene |
| Chlorodinitronaphthalene |
| chlorodinitronaphtalenes |
| 2,4-Dinitro-1-chloro-naphthalene |
| 2,4-dinitrochloronnaphthalene |