Introduction:Basic information about CAS 108957-73-9|3,4',5-trimethoxy-3'-hydroxystilbene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4',5-trimethoxy-3'-hydroxystilbene |
|---|
| CAS Number | 108957-73-9 | Molecular Weight | 286.322 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 472.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H18O4 | Melting Point | 89 - 91ºC |
|---|
| MSDS | / | Flash Point | 239.7±28.7 °C |
|---|
Names
| Name | 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxy-phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 472.8±45.0 °C at 760 mmHg |
|---|
| Melting Point | 89 - 91ºC |
|---|
| Molecular Formula | C17H18O4 |
|---|
| Molecular Weight | 286.322 |
|---|
| Flash Point | 239.7±28.7 °C |
|---|
| Exact Mass | 286.120514 |
|---|
| PSA | 47.92000 |
|---|
| LogP | 3.81 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | UQIWTPQGJCCTPA-SNAWJCMRSA-N |
|---|
| SMILES | COc1cc(C=Cc2ccc(OC)c(O)c2)cc(OC)c1 |
|---|
Safety Information
Customs
| HS Code | 2909500000 |
|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| trans-3'-hydroxy-3,4',5-trimethoxystilbene |
| trans-3,4',5-trimethoxy-3'-hydroxystilbene |
| (Z) 5-[2-(3,5-Dimethoxy-phenyl)-vinyl]-2-methoxy-phenol |
| Phenol, 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxy- |
| 3,4',5-trimethylpiceatannol |
| 4,3',5'-tri-O-methylpiceatannol |
| (E)-3'-hydroxy-3,4',5-trimethoxystilbene |
| 5-[(E)-2-(3,5-dimeth |
| 3,4',5-trimethoxy-3'-hydroxystilbene |
| 5-[(E)-2-(3,5-Dimethoxyphenyl)vinyl]-2-methoxyphenol |
| (E)-3'-Hydroxy-3,5,4'-trimethoxystilbene |
| 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenol |