Introduction：Basic information about CAS 83508-62-7|N-methyl-N-[3-(trifluoromethyl)phenyl]carbamothioyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-methyl-N-[3-(trifluoromethyl)phenyl]carbamothioyl chloride |
|---|
| CAS Number | 83508-62-7 | Molecular Weight | 253.67200 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 268.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7ClF3NS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 115.9ºC |
|---|
Names
| Name | N-methyl-N-[3-(trifluoromethyl)phenyl]carbamothioyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 268.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7ClF3NS |
|---|
| Molecular Weight | 253.67200 |
|---|
| Flash Point | 115.9ºC |
|---|
| Exact Mass | 252.99400 |
|---|
| PSA | 35.33000 |
|---|
| LogP | 3.66530 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | VOXCSWSUZAYCOQ-UHFFFAOYSA-N |
|---|
| SMILES | CN(C(=S)Cl)c1cccc(C(F)(F)F)c1 |
|---|
