Introduction：Basic information about CAS 113111-32-3|1,2-Cyclopropanedicarboxylic acid, 1-(4-methylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Cyclopropanedicarboxylic acid, 1-(4-methylphenyl)- |
|---|
| CAS Number | 113111-32-3 | Molecular Weight | 220.22100 |
|---|
| Density | 1.406g/cm3 | Boiling Point | 409.342ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.518ºC |
|---|
Names
| Name | 1-(4-methylphenyl)cyclopropane-1,2-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.406g/cm3 |
|---|
| Boiling Point | 409.342ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12O4 |
|---|
| Molecular Weight | 220.22100 |
|---|
| Flash Point | 215.518ºC |
|---|
| Exact Mass | 220.07400 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.42190 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | RIDXNPOAOROPNF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C2(C(=O)O)CC2C(=O)O)cc1 |
|---|
Synonyms
| CYC002 |
| X4662 |
| cis-1-p-tolyl-1,2-cyclopropanedicarboxylic acid |
