Introduction:Basic information about CAS 14585-04-7|5,7-DIHYDROXY-3,3',4',5'-TETRAMETHOXYFLAVONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,7-DIHYDROXY-3,3',4',5'-TETRAMETHOXYFLAVONE |
|---|
| CAS Number | 14585-04-7 | Molecular Weight | 374.34100 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 594.2ºC at 760mmHg |
|---|
| Molecular Formula | C19H18O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 214.3ºC |
|---|
Names
| Name | 5,7-dihydroxy-3-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 594.2ºC at 760mmHg |
|---|
| Molecular Formula | C19H18O8 |
|---|
| Molecular Weight | 374.34100 |
|---|
| Flash Point | 214.3ºC |
|---|
| Exact Mass | 374.10000 |
|---|
| PSA | 107.59000 |
|---|
| LogP | 2.90560 |
|---|
| Vapour Pressure | 1.02E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | YSXLGTWJLNLXKQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc(OC)c1OC |
|---|
Safety Information
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5,7-Dihydroxy-3,3',4',5'-tetramethoxyflavon |
| 5,7-dihydroxy-3,3',4',5'-tetramethoxyflavone |
| 3',3',4',5'-tetra-O-methylmyricetin |
| 5,7-Dihydroxy-3-methoxy-2-(3,4,5-trimethoxy-phenyl)-chromen-4-on |
| 3,3',4',5'-Tetramethyl-myricetin |
| 5,7-dihydroxy-3-methoxy-2-(3,4,5-trimethoxy-phenyl)-chromen-4-one |
| Myricetin 3,3',4',5'-tetramethyl ether |