Introduction：Basic information about CAS 307353-98-6|Methyl [(4-chloro-3-cyano-7-methoxy-6-quinolinyl)oxy]acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl [(4-chloro-3-cyano-7-methoxy-6-quinolinyl)oxy]acetate |
|---|
| CAS Number | 307353-98-6 | Molecular Weight | 306.70100 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 461.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11ClN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.9ºC |
|---|
Names
| Name | Methyl [(4-chloro-3-cyano-7-methoxy-6-quinolinyl)oxy]acetate |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 461.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11ClN2O4 |
|---|
| Molecular Weight | 306.70100 |
|---|
| Flash Point | 232.9ºC |
|---|
| Exact Mass | 306.04100 |
|---|
| PSA | 81.44000 |
|---|
| LogP | 2.32028 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | XCATUHBYTRDKCR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)COc1cc2c(Cl)c(C#N)cnc2cc1OC |
|---|
