Introduction：Basic information about CAS 884497-30-7|2-amino-4-(4-butan-2-ylphenyl)-5-methylthiophene-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-amino-4-(4-butan-2-ylphenyl)-5-methylthiophene-3-carbonitrile |
|---|
| CAS Number | 884497-30-7 | Molecular Weight | 270.39300 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 418.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.8ºC |
|---|
Names
| Name | 2-amino-4-(4-butan-2-ylphenyl)-5-methylthiophene-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 418.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18N2S |
|---|
| Molecular Weight | 270.39300 |
|---|
| Flash Point | 206.8ºC |
|---|
| Exact Mass | 270.11900 |
|---|
| PSA | 78.05000 |
|---|
| LogP | 5.27208 |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | JTLRHJQWMVNWFI-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)c1ccc(-c2c(C)sc(N)c2C#N)cc1 |
|---|
