Introduction:Basic information about CAS 55463-74-6|1H-Pyrrolo[2,3-b]pyridin-6-amine, 2,3-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrolo[2,3-b]pyridin-6-amine, 2,3-diphenyl- |
|---|
| CAS Number | 55463-74-6 | Molecular Weight | 285.34300 |
|---|
| Density | 1.251g/cm3 | Boiling Point | 510.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 295.3ºC |
|---|
Names
| Name | 2,3-diphenyl-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.251g/cm3 |
|---|
| Boiling Point | 510.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15N3 |
|---|
| Molecular Weight | 285.34300 |
|---|
| Flash Point | 295.3ºC |
|---|
| Exact Mass | 285.12700 |
|---|
| PSA | 54.70000 |
|---|
| LogP | 5.06030 |
|---|
| Index of Refraction | 1.72 |
|---|
| InChIKey | BWLVTKFELPKODG-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c(-c3ccccc3)c(-c3ccccc3)[nH]c2n1 |
|---|
Synonyms
| 2,3-diphenyl-1H-pyrrolo[2,3-b]pyridin-6-ylamine |
| 1H-Pyrrolo[2,3-b]pyridin-6-amine,2,3-diphenyl |
| 6-Amino-2,3-diphenyl(1H)pyrrolo[2,3-b]pyridine |
| 6-Amino-2,3-diphenyl-1H-pyrrolo<2.3-b>pyridin |