Introduction：Basic information about CAS 754214-54-5|1H-Pyrrolo[2,3-b]pyridine, 5-bromo-1-[(1,1-dimethylethyl)dimethylsilyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-1-[(1,1-dimethylethyl)dimethylsilyl]- |
|---|
| CAS Number | 754214-54-5 | Molecular Weight | 311.29300 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 286.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19BrN2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127ºC |
|---|
Names
| Name | 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-1-[(1,1-dimethylethyl)dimethylsilyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 286.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19BrN2Si |
|---|
| Molecular Weight | 311.29300 |
|---|
| Flash Point | 127ºC |
|---|
| Exact Mass | 310.05000 |
|---|
| PSA | 17.82000 |
|---|
| LogP | 4.65210 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | WJPYOLVKLXHGIE-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](C)(C)n1ccc2cc(Br)cnc21 |
|---|
Synonyms
| 5-Bromo-1-(methylsulfonyl)indole |
| N-methanesulfonyl-5-bromoindole |
| 5-bromo-1-(tert-butyldimethylsilanyl)-1H-pyrrolo[2,3-b]pyridine |
| 5-bromo-1-(methanesulfonyl)-1H-indole |
| 1H-Indole,5-bromo-1-(methylsulfonyl) |
