Introduction：Basic information about CAS 754214-45-4|1H-Pyrrolo[2,3-b]pyridine-5-methanol, 1-[(1,1-dimethylethyl)dimethylsilyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrolo[2,3-b]pyridine-5-methanol, 1-[(1,1-dimethylethyl)dimethylsilyl]- |
|---|
| CAS Number | 754214-45-4 | Molecular Weight | 262.42300 |
|---|
| Density | 1.03g/cm3 | Boiling Point | 316.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H22N2OSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.3ºC |
|---|
Names
| Name | 1H-Pyrrolo[2,3-b]pyridine-5-methanol, 1-[(1,1-dimethylethyl)dimethylsilyl] |
|---|
Chemical & Physical Properties
| Density | 1.03g/cm3 |
|---|
| Boiling Point | 316.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H22N2OSi |
|---|
| Molecular Weight | 262.42300 |
|---|
| Flash Point | 145.3ºC |
|---|
| Exact Mass | 262.15000 |
|---|
| PSA | 38.05000 |
|---|
| LogP | 3.38190 |
|---|
| Index of Refraction | 1.53 |
|---|
| InChIKey | BRKLHDBBGKKMRP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](C)(C)n1ccc2cc(CO)cnc21 |
|---|
