Introduction:Basic information about CAS 3096-76-2|3-oxo-1,3-dihydro-benzo[c]isoxazole-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-oxo-1,3-dihydro-benzo[c]isoxazole-4-carboxylic acid |
|---|
| CAS Number | 3096-76-2 | Molecular Weight | 179.130 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 403.9±47.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5NO4 | Melting Point | 191 °C(decomp) |
|---|
| MSDS | / | Flash Point | 198.1±29.3 °C |
|---|
Names
| Name | 3-Oxo-1,3-dihydro-2,1-benzoxazole-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 403.9±47.0 °C at 760 mmHg |
|---|
| Melting Point | 191 °C(decomp) |
|---|
| Molecular Formula | C8H5NO4 |
|---|
| Molecular Weight | 179.130 |
|---|
| Flash Point | 198.1±29.3 °C |
|---|
| Exact Mass | 179.021851 |
|---|
| PSA | 83.30000 |
|---|
| LogP | 1.10 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | HJRQDIDWKHJPEV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc2[nH]oc(=O)c12 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-oxo-1,3-dihydroisobenzofuran-3-carboxylic acid |
| 3-oxo-1,3-dihydro-2-benzofuran-1-carboxylic acid |
| 3-phthalidecarboxylic acid |
| phthalide-3-carboxylic acid |
| 3-oxo-1,3-dihydroisobenzofuran-1-carboxylic acid |
| 3-oxo-1,3-dihidroisobenzofuran-1-carboxylic acid |
| 2,1-Benzisoxazole-4-carboxylic acid, 1,3-dihydro-3-oxo- |
| 3-Oxo-1,3-dihydro-2,1-benzoxazole-4-carboxylic acid |
| 4-Carboxy-benzisoxazolon |
| 3-carboxyphthalide |