Introduction：Basic information about CAS 33693-84-4|tert-butyl hydrogen phthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl hydrogen phthalate |
|---|
| CAS Number | 33693-84-4 | Molecular Weight | 222.23700 |
|---|
| Density | 1.173g/cm3 | Boiling Point | 349.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O4 | Melting Point | 79-80°C |
|---|
| MSDS | / | Flash Point | 131.8ºC |
|---|
Names
| Name | 2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.173g/cm3 |
|---|
| Boiling Point | 349.8ºC at 760mmHg |
|---|
| Melting Point | 79-80°C |
|---|
| Molecular Formula | C12H14O4 |
|---|
| Molecular Weight | 222.23700 |
|---|
| Flash Point | 131.8ºC |
|---|
| Exact Mass | 222.08900 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 2.34010 |
|---|
| InChIKey | PBUQZKXKYSAJDO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1ccccc1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Phthalsaeure-mono-tert-butylester |
| phthalic acid mono-tert-butyl ester |
| t-Butyl hydrogen phthalate |
| 2-(tert-Butoxycarbonyl)benzoic acid |
| t-Monobutyl phthalate |
| tert-Butyl hydrogen phthalate |
| MFCD00043711 |
| 2-[(tert-butyl)oxycarbonyl]benzoic acid |
