Introduction:Basic information about CAS 81439-28-3|Methanesulfonic acid, trifluoro-, dianhydride with carbonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanesulfonic acid, trifluoro-, dianhydride with carbonic acid |
|---|
| CAS Number | 81439-28-3 | Molecular Weight | 326.2 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C3F6O7S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methanesulfonic acid, trifluoro-, dianhydride with carbonic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C3F6O7S2 |
|---|
| Molecular Weight | 326.2 |
|---|
| InChIKey | YGZDJAVEFIDVAI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
|---|