Introduction：Basic information about CAS 111058-26-5|Antimonate(1-), hexafluoro-, (OC-6-11)-, salt with N1,N1,N4,N4-tetrakis(4-(dipropyla, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Antimonate(1-), hexafluoro-, (OC-6-11)-, salt with N1,N1,N4,N4-tetrakis(4-(dipropylamino)phenyl)-1,4-benzenediamine (1:1) |
|---|
| CAS Number | 111058-26-5 | Molecular Weight | 1045.0 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C54H76F6N6Sb- | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Antimonate(1-), hexafluoro-, (OC-6-11)-, salt with N1,N1,N4,N4-tetrakis(4-(dipropylamino)phenyl)-1,4-benzenediamine (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C54H76F6N6Sb- |
|---|
| Molecular Weight | 1045.0 |
|---|
| InChIKey | DDTWFIUDQLWYHQ-UHFFFAOYSA-H |
|---|
| SMILES | CCCN(CCC)c1ccc(N(c2ccc(N(CCC)CCC)cc2)c2ccc(N(c3ccc(N(CCC)CCC)cc3)c3ccc(N(CCC)CCC)cc3)cc2)cc1.F[Sb-](F)(F)(F)(F)F |
|---|
