Introduction:Basic information about CAS 950385-77-0|3-[(3-Ethyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)amino]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(3-Ethyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)amino]benzoic acid |
|---|
| CAS Number | 950385-77-0 | Molecular Weight | 333.3 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H15N5O2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 3-[(3-Ethyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)amino]benzoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H15N5O2 |
|---|
| Molecular Weight | 333.3 |
|---|
| InChIKey | INDKHRIZOIEPIG-UHFFFAOYSA-N |
|---|
| SMILES | CCc1nnc2c3ccccc3nc(Nc3cccc(C(=O)O)c3)n12 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|