Introduction:Basic information about CAS 31567-29-0|Terephthalic acid, monoester with propane-1,2-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Terephthalic acid, monoester with propane-1,2-diol |
|---|
| CAS Number | 31567-29-0 | Molecular Weight | 224.21 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Terephthalic acid, monoester with propane-1,2-diol |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H12O5 |
|---|
| Molecular Weight | 224.21 |
|---|
| InChIKey | OAJXYMDMOKNADM-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)COC(=O)c1ccc(C(=O)O)cc1 |
|---|