Introduction:Basic information about CAS 213740-80-8|Iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, salt with perfluoro-1-octanesulfonic ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, salt with perfluoro-1-octanesulfonic acid (1:1) |
|---|
| CAS Number | 213740-80-8 | Molecular Weight | 892.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C28H26F17IO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, salt with perfluoro-1-octanesulfonic acid (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C28H26F17IO3S |
|---|
| Molecular Weight | 892.4 |
|---|
| InChIKey | GGKNUPBFZOOSQW-UHFFFAOYSA-M |
|---|
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|