Introduction:Basic information about CAS 1892582-87-4|Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 2,2-difluoro-2-sulfoethyl ester, comp, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 2,2-difluoro-2-sulfoethyl ester, compd. with pyridine |
|---|
| CAS Number | 1892582-87-4 | Molecular Weight | 403.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H23F2NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 2,2-difluoro-2-sulfoethyl ester, compd. with pyridine |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H23F2NO5S |
|---|
| Molecular Weight | 403.4 |
|---|
| InChIKey | LKUYMIGEOKACOB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC(CC(C3)C1)C2.c1ccncc1 |
|---|