Introduction:Basic information about CAS 94115-09-0|Carbamic acid, dimethyldithio-, anhydrosulfide with O-methyl (p-chlorophenyl)phosphon, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carbamic acid, dimethyldithio-, anhydrosulfide with O-methyl (p-chlorophenyl)phosphonodithioate |
|---|
| CAS Number | 94115-09-0 | Molecular Weight | 325.8 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H13ClNOPS3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Carbamic acid, dimethyldithio-, anhydrosulfide with O-methyl (p-chlorophenyl)phosphonodithioate |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H13ClNOPS3 |
|---|
| Molecular Weight | 325.8 |
|---|
| InChIKey | SZTYNLSGXOWKQW-UHFFFAOYSA-N |
|---|
| SMILES | COP(=S)(SC(=S)N(C)C)c1ccc(Cl)cc1 |
|---|