Introduction：Basic information about CAS 116597-67-2|Glycine, N-cinnamoyl-, ester with chloramphenicol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Glycine, N-cinnamoyl-, ester with chloramphenicol |
|---|
| CAS Number | 116597-67-2 | Molecular Weight | 510.3 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C22H21Cl2N3O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Glycine, N-cinnamoyl-, ester with chloramphenicol |
|---|
Chemical & Physical Properties
| Molecular Formula | C22H21Cl2N3O7 |
|---|
| Molecular Weight | 510.3 |
|---|
| InChIKey | LTAFDQVXPJUTPB-YLJYHZDGSA-N |
|---|
| SMILES | O=C(C=Cc1ccccc1)NCC(=O)OCC(NC(=O)C(Cl)Cl)C(O)c1ccc([N+](=O)[O-])cc1 |
|---|
