Introduction:Basic information about CAS 162635-10-1|1,3-Dioxane-5-carboxylic acid, 2,2,5-trimethyl-, anhydride with 2,4,6-trichlorobenzo, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Dioxane-5-carboxylic acid, 2,2,5-trimethyl-, anhydride with 2,4,6-trichlorobenzoic acid |
|---|
| CAS Number | 162635-10-1 | Molecular Weight | 381.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H15Cl3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,3-Dioxane-5-carboxylic acid, 2,2,5-trimethyl-, anhydride with 2,4,6-trichlorobenzoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H15Cl3O5 |
|---|
| Molecular Weight | 381.6 |
|---|
| InChIKey | FZTHYIFJZAFXJQ-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OCC(C)(C(=O)OC(=O)c2c(Cl)cc(Cl)cc2Cl)CO1 |
|---|