Introduction:Basic information about CAS 332350-93-3|Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-meth, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
|---|
| CAS Number | 332350-93-3 | Molecular Weight | 665.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C30H25F9NO2PS | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C30H25F9NO2PS |
|---|
| Molecular Weight | 665.5 |
|---|
| InChIKey | WYLPQVAOXDLNOX-UHFFFAOYSA-N |
|---|
| SMILES | C[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|---|